EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O16P2 |
| Net Charge | -2 |
| Average Mass | 534.260 |
| Monoisotopic Mass | 534.02990 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])O[C@H]3OC[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H22N2O16P2/c17-5-3-28-13(11(22)8(5)19)31-34(26,27)32-33(24,25)29-4-6-9(20)10(21)12(30-6)16-2-1-7(18)15-14(16)23/h1-2,5-6,8-13,17,19-22H,3-4H2,(H,24,25)(H,26,27)(H,15,18,23)/p-2/t5-,6+,8-,9+,10+,11+,12+,13+/m0/s1 |
| InChIKey | DQQDLYVHOTZLOR-IAZOVDBXSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-β-L-arabinopyranose(2−) (CHEBI:61457) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| UDP-β-L-arabinopyranose(2−) (CHEBI:61457) is conjugate base of UDP-β-L-arabinopyranose (CHEBI:61455) |
| Incoming Relation(s) |
| UDP-β-L-arabinopyranose (CHEBI:61455) is conjugate acid of UDP-β-L-arabinopyranose(2−) (CHEBI:61457) |
| IUPAC Name |
|---|
| uridine 5'-[3-(β-L-arabinopyranosyl) diphosphate] |
| Synonyms | Source |
|---|---|
| UDP-β-L-arabinopyranose dianion | ChEBI |
| UDP-β-L-Arap(2−) | ChEBI |
| UDP-β-L-Arap dianion | ChEBI |
| uridine 5'-diphospho-β-L-arabinopyranose(2−) | ChEBI |
| uridine 5'-diphospho-β-L-arabinopyranose dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| UDP-β-L-arabinopyranose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12513 | MetaCyc |
| Citations |
|---|