EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O4 |
| Net Charge | -1 |
| Average Mass | 181.167 |
| Monoisotopic Mass | 181.05063 |
| SMILES | O=C([O-])/C=C/C1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,7,9-10,13H,(H,11,12)/p-1/b5-4+/t7-,9+/m0/s1 |
| InChIKey | AEUBLTTWYCDTGM-HXOXMVQHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylate (CHEBI:61451) is a 3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylate (CHEBI:60108) |
| (E)-3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylate (CHEBI:61451) is conjugate base of (E)-3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylic acid (CHEBI:61462) |
| Incoming Relation(s) |
| (E)-3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylic acid (CHEBI:61462) is conjugate acid of (E)-3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylate (CHEBI:61451) |
| IUPAC Name |
|---|
| (2E)-3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylate |
| Synonyms | Source |
|---|---|
| (2E)-3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)acrylate | ChEBI |
| (E)-3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylate(1−) | ChEBI |
| (E)-3-[(5S,6R)-5,6-dihydroxycyclohexa-1,3-dienyl]acrylate anion | ChEBI |
| (E)-3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (2E)-3-(cis-5,6-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoate | UniProt |