EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O9 |
| Net Charge | 0 |
| Average Mass | 342.300 |
| Monoisotopic Mass | 342.09508 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H18O9/c16-6-10-12(20)13(21)14(22)15(23-10)24-11(19)4-2-7-1-3-8(17)9(18)5-7/h1-5,10,12-18,20-22H,6H2/b4-2+/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | WQSDYZZEIBAPIN-VBQORRLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-caffeoyl-β-D-glucose (CHEBI:614) has functional parent trans-caffeic acid (CHEBI:16433) |
| 1-caffeoyl-β-D-glucose (CHEBI:614) has role plant metabolite (CHEBI:76924) |
| 1-caffeoyl-β-D-glucose (CHEBI:614) is a catechols (CHEBI:33566) |
| 1-caffeoyl-β-D-glucose (CHEBI:614) is a cinnamate ester (CHEBI:36087) |
| 1-caffeoyl-β-D-glucose (CHEBI:614) is a monosaccharide derivative (CHEBI:63367) |
| 1-caffeoyl-β-D-glucose (CHEBI:614) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1-O-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-β-D-glucopyranose |
| UniProt Name | Source |
|---|---|
| 1-O-[(E)-caffeoyl]-β-D-glucose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C10433 | KEGG COMPOUND |
| C00002718 | KNApSAcK |
| HMDB0036937 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1295557 | Reaxys |
| CAS:14364-08-0 | KEGG COMPOUND |