EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O2 |
| Net Charge | 0 |
| Average Mass | 280.452 |
| Monoisotopic Mass | 280.24023 |
| SMILES | O=C(O)CCCCCCCCCCCC[C@H]1C=CCC1 |
| InChI | InChI=1S/C18H32O2/c19-18(20)16-10-8-6-4-2-1-3-5-7-9-13-17-14-11-12-15-17/h11,14,17H,1-10,12-13,15-16H2,(H,19,20)/t17-/m0/s1 |
| InChIKey | XMVQWNRDPAAMJB-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-chaulmoogric acid (CHEBI:61389) is a chaulmoogric acid (CHEBI:27939) |
| IUPAC Name |
|---|
| 13-[(1R)-cyclopent-2-en-1-yl]tridecanoic acid |
| Synonyms | Source |
|---|---|
| 13-(R)-cyclopent-2-enyl-tridecanoic acid | ChEBI |
| 13-[(R)-cyclopent-2-enyl]-tridecanoic acid | ChEBI |
| 13-[(R)-Cyclopent-2-enyl]-tridecansaüre | ChEBI |
| 13-(R)-Cyclopent-2-enyl-tridecansäure | ChEBI |
| acide (R)-chaulmoogrique | ChEBI |
| ácido (R)-chaulmógrico | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3204530 | Reaxys |