EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O5 |
| Net Charge | 0 |
| Average Mass | 260.245 |
| Monoisotopic Mass | 260.06847 |
| SMILES | COc1c2occc2c(OC)c2c(=O)cc(C)oc12 |
| InChI | InChI=1S/C14H12O5/c1-7-6-9(15)10-11(16-2)8-4-5-18-12(8)14(17-3)13(10)19-7/h4-6H,1-3H3 |
| InChIKey | HSMPDPBYAYSOBC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ammi visnaga (ncbitaxon:1053409) | |||
| seed (BTO:0001226) | PubMed (28166217) | ||
| leaf (BTO:0000713) | PubMed (28166217) |
| Roles Classification |
|---|
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-asthmatic agent Any compound that has anti-asthmatic effects. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| khellin (CHEBI:6133) has functional parent 5H-furo[3,2-g]chromen-5-one (CHEBI:173072) |
| khellin (CHEBI:6133) has role anti-asthmatic agent (CHEBI:65023) |
| khellin (CHEBI:6133) has role bronchodilator agent (CHEBI:35523) |
| khellin (CHEBI:6133) has role cardiovascular drug (CHEBI:35554) |
| khellin (CHEBI:6133) has role vasodilator agent (CHEBI:35620) |
| khellin (CHEBI:6133) is a furanochromone (CHEBI:137443) |
| khellin (CHEBI:6133) is a organic heterotricyclic compound (CHEBI:26979) |
| khellin (CHEBI:6133) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| 4,9-dimethoxy-7-methyl-5H-furo[3,2-g]chromen-5-one |
| INNs | Source |
|---|---|
| khellinum | ChemIDplus |
| quelina | ChemIDplus |
| khellin | ChemIDplus |
| khelline | ChemIDplus |
| Synonym | Source |
|---|---|
| 4,9-dimethoxy-7-methyl-5H-furo[3,2-g][1]benzopyran-5-one | IUPAC |
| Citations |
|---|