EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H20ClN7O11S3 |
| Net Charge | 0 |
| Average Mass | 774.171 |
| Monoisotopic Mass | 773.00715 |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccc(S(=O)(=O)O)c(Nc3nc(Cl)nc(Nc4cccc(S(=O)(=O)O)c4)n3)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H20ClN7O11S3/c30-27-35-28(33-13-4-3-5-15(10-13)49(40,41)42)37-29(36-27)34-18-11-14(8-9-20(18)50(43,44)45)32-19-12-21(51(46,47)48)24(31)23-22(19)25(38)16-6-1-2-7-17(16)26(23)39/h1-12,32H,31H2,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H2,33,34,35,36,37) |
| InChIKey | NSDSIQGBHACTLY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Reactive Blue 5 (CHEBI:61311) has role dye (CHEBI:37958) |
| Reactive Blue 5 (CHEBI:61311) is a anthraquinone (CHEBI:22580) |
| Reactive Blue 5 (CHEBI:61311) is conjugate acid of Reactive Blue 5(3−) (CHEBI:61331) |
| Incoming Relation(s) |
| Reactive Blue 5(3−) (CHEBI:61331) is conjugate base of Reactive Blue 5 (CHEBI:61311) |
| IUPAC Name |
|---|
| 1-amino-4-{[3-({4-chloro-6-[(3-sulfophenyl)amino]-1,3,5-triazin-2-yl}amino)-4-sulfophenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid |
| Synonyms | Source |
|---|---|
| 1-Amino-4-{[3-({4-chloro-6-[(3-sulfophenyl)amino]-1,3,5-triazin-2-yl}amino)-4-sulfophenyl]amino}-9,10-dihydro-9,10-dioxoanthracene-2-sulfonic acid | JCBN |
| RB5 | ChEBI |
| R. blue 5 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6997271 | Reaxys |
| Citations |
|---|