EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H48O3 |
| Net Charge | 0 |
| Average Mass | 384.645 |
| Monoisotopic Mass | 384.36035 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C24H48O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(25)24(26)27/h23,25H,2-22H2,1H3,(H,26,27) |
| InChIKey | MSUOLNSQHLHDAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cerebronic acid (CHEBI:61302) has functional parent tetracosanoic acid (CHEBI:28866) |
| cerebronic acid (CHEBI:61302) is a 2-hydroxy fatty acid (CHEBI:10283) |
| cerebronic acid (CHEBI:61302) is a straight-chain fatty acid (CHEBI:59202) |
| cerebronic acid (CHEBI:61302) is a very long-chain fatty acid (CHEBI:27283) |
| cerebronic acid (CHEBI:61302) is conjugate acid of 2-hydroxytetracosanoate (CHEBI:76723) |
| Incoming Relation(s) |
| N-(2-hydroxylignoceroyl)-D-galactosylsphingosine (CHEBI:83873) has functional parent cerebronic acid (CHEBI:61302) |
| N-2-hydroxylignoceroylsphingosine (CHEBI:76756) has functional parent cerebronic acid (CHEBI:61302) |
| 2-hydroxytetracosanoyl-CoA (CHEBI:74140) has functional parent cerebronic acid (CHEBI:61302) |
| 2-hydroxytetracosanoate (CHEBI:76723) is conjugate base of cerebronic acid (CHEBI:61302) |
| IUPAC Name |
|---|
| 2-hydroxytetracosanoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxylignoceric acid | ChEBI |
| 2-Hydroxy-tetracosansäure | ChEBI |
| 2-hydroxytetraeicosanoic acid | ChEBI |
| 2-hydroxytetraicosanoic acid | ChEBI |
| acide cerebronique | ChEBI |
| Cerebronsäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728966 | Reaxys |
| CAS:544-57-0 | ChemIDplus |
| Citations |
|---|