EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22NO4.Cl |
| Net Charge | 0 |
| Average Mass | 339.819 |
| Monoisotopic Mass | 339.12374 |
| SMILES | [Cl-].[H][C@]12CC[C@]([H])([C@@H](C(=O)OC)[C@@H](OC(=O)c3ccccc3)C1)[NH+]2C |
| InChI | InChI=1S/C17H21NO4.ClH/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11;/h3-7,12-15H,8-10H2,1-2H3;1H/t12-,13+,14-,15+;/m0./s1 |
| InChIKey | PIQVDUKEQYOJNR-VZXSFKIWSA-N |
| Roles Classification |
|---|
| Applications: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cocaine hydrochloride (CHEBI:613010) has part cocaine(1+) (CHEBI:60056) |
| cocaine hydrochloride (CHEBI:613010) has role central nervous system stimulant (CHEBI:35337) |
| cocaine hydrochloride (CHEBI:613010) has role local anaesthetic (CHEBI:36333) |
| cocaine hydrochloride (CHEBI:613010) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (1R,2R,3S,5S)-3-(benzoyloxy)-2-(methoxycarbonyl)-8-methyl-8-azoniabicyclo[3.2.1]octane chloride |
| Synonyms | Source |
|---|---|
| Cocain-chlorhydrat | ChemIDplus |
| Cocaine chloride | ChemIDplus |
| Cocaine HCl | ChemIDplus |
| Cocaine muriate | ChemIDplus |
| l-Cocaine hydrochloride | ChemIDplus |