EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13O7P |
| Net Charge | 0 |
| Average Mass | 228.137 |
| Monoisotopic Mass | 228.03989 |
| SMILES | CC(C)(COP(=O)(O)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H13O7P/c1-6(2,4(7)5(8)9)3-13-14(10,11)12/h4,7H,3H2,1-2H3,(H,8,9)(H2,10,11,12)/t4-/m0/s1 |
| InChIKey | SVZWVVFMSSSVKX-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-4-phosphopantoic acid (CHEBI:61291) has functional parent (R)-pantoic acid (CHEBI:18697) |
| (R)-4-phosphopantoic acid (CHEBI:61291) is a carboxyalkyl phosphate (CHEBI:36952) |
| (R)-4-phosphopantoic acid (CHEBI:61291) is conjugate acid of (R)-4-phosphonatopantoate(3−) (CHEBI:61294) |
| Incoming Relation(s) |
| (R)-4-phosphonatopantoate(3−) (CHEBI:61294) is conjugate base of (R)-4-phosphopantoic acid (CHEBI:61291) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3,3-dimethyl-4-(phosphonooxy)butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C18911 | KEGG COMPOUND |
| Citations |
|---|