EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H70MgN4O6 |
| Net Charge | 0 |
| Average Mass | 907.492 |
| Monoisotopic Mass | 906.51458 |
| SMILES | [H]C(=O)c1c(C=C)c2[n]3c1/C=C1/[C@@H](C)[C@H](CCC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C4=[N]1->[Mg]31<-[N]3=C(/C=c5/c(C)c6c([n]51)=C4[C@@H](C(=O)OC)C6=O)C(CC)=C(C)/C3=C/2 |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorophyll f (CHEBI:61290) is a chlorophyll (CHEBI:28966) |
| chlorophyll f (CHEBI:61290) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| [methyl 14-ethyl-8-formyl-4,13,18-trimethyl-20-oxo-3-{3-oxo-3-[(3,7,11,15-tetramethylhexadec-2-en-1-yl)oxy]propyl}-9-vinylphorbine-21-carboxylatato(2−)-κ4N23,N24,N25,N26]magnesium |
| Citations |
|---|