EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61276 - scopolamine methobromide
| Formula | Br.C18H24NO4 |
| Net Charge | 0 |
| Average Mass | 398.297 |
| Monoisotopic Mass | 397.08887 |
| SMILES | C[N+]1(C)[C@@H]2C[C@@H](OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12.[Br-] |
| InChI | InChI=1S/C18H24NO4.BrH/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11;/h3-7,12-17,20H,8-10H2,1-2H3;1H/q+1;/p-1/t12-,13-,14-,15+,16-,17+;/m1./s1 |
| InChIKey | CXYRUNPLKGGUJF-RAFJPFSSSA-M |
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scopolamine methobromide (CHEBI:61276) has functional parent scopolamine (CHEBI:16794) |
| scopolamine methobromide (CHEBI:61276) has role antiemetic (CHEBI:50919) |
| scopolamine methobromide (CHEBI:61276) has role antispasmodic drug (CHEBI:53784) |
| scopolamine methobromide (CHEBI:61276) has role muscarinic antagonist (CHEBI:48876) |
| scopolamine methobromide (CHEBI:61276) has role parasympatholytic (CHEBI:50370) |
| scopolamine methobromide (CHEBI:61276) is a bromide salt (CHEBI:22925) |
| scopolamine methobromide (CHEBI:61276) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (1R,2R,4S,5S,7s)-7-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane |
| INN | Source |
|---|---|
| hyoscine methobromide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (−)-(1S,3s,5R,6R,7S)-6,7-epoxy-8-methyl-3-[(S)-tropoyloxy]tropanium bromide | ChEBI |
| N-methylhyoscine bromide | DrugBank |
| N-methylscopolammonium bromide | ChemIDplus |
| hyoscine methyl bromide | ChemIDplus |
| (S)-6β,7β-epoxy-8-methyl-3α-(−)-tropoyloxy-1αH,5αH-tromanium bromide | ChemIDplus |
| methscopolamine bromide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pamine | KEGG DRUG |