EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C18H24NO4 |
| Net Charge | 0 |
| Average Mass | 398.297 |
| Monoisotopic Mass | 397.08887 |
| SMILES | C[N+]1(C)[C@@H]2C[C@@H](OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12.[Br-] |
| InChI | InChI=1S/C18H24NO4.BrH/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11;/h3-7,12-17,20H,8-10H2,1-2H3;1H/q+1;/p-1/t12-,13-,14-,15+,16-,17+;/m1./s1 |
| InChIKey | CXYRUNPLKGGUJF-RAFJPFSSSA-M |
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scopolamine methobromide (CHEBI:61276) has functional parent scopolamine (CHEBI:16794) |
| scopolamine methobromide (CHEBI:61276) has role antiemetic (CHEBI:50919) |
| scopolamine methobromide (CHEBI:61276) has role antispasmodic drug (CHEBI:53784) |
| scopolamine methobromide (CHEBI:61276) has role muscarinic antagonist (CHEBI:48876) |
| scopolamine methobromide (CHEBI:61276) has role parasympatholytic (CHEBI:50370) |
| scopolamine methobromide (CHEBI:61276) is a bromide salt (CHEBI:22925) |
| scopolamine methobromide (CHEBI:61276) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (1R,2R,4S,5S,7s)-7-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane |
| INN | Source |
|---|---|
| hyoscine methobromide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (−)-(1S,3s,5R,6R,7S)-6,7-epoxy-8-methyl-3-[(S)-tropoyloxy]tropanium bromide | ChEBI |
| N-methylhyoscine bromide | DrugBank |
| N-methylscopolammonium bromide | ChemIDplus |
| hyoscine methyl bromide | ChemIDplus |
| (S)-6β,7β-epoxy-8-methyl-3α-(−)-tropoyloxy-1αH,5αH-tromanium bromide | ChemIDplus |
| methscopolamine bromide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pamine | KEGG DRUG |