EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42O8 |
| Net Charge | 0 |
| Average Mass | 470.603 |
| Monoisotopic Mass | 470.28797 |
| SMILES | [H][C@@]12C[C@]3([H])O[C@]4([H])[C@@H](C)[C@H](C)[C@@]5(CCCO5)O[C@@]4([H])[C@@H](O)[C@H](C)[C@@]3([H])O[C@@]1([H])C[C@@H](C)C[C@@H](CO)[C@H](O)O2 |
| InChI | InChI=1S/C25H42O8/c1-12-8-16(11-26)24(28)32-18-10-19-21(30-17(18)9-12)14(3)20(27)23-22(31-19)13(2)15(4)25(33-23)6-5-7-29-25/h12-24,26-28H,5-11H2,1-4H3/t12-,13-,14-,15-,16-,17-,18+,19-,20-,21+,22+,23-,24+,25+/m0/s1 |
| InChIKey | HJJQSMPHORHGHP-ZMPMLXEHSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciguatoxin IJKLM ring fragment (CHEBI:61261) has role hapten (CHEBI:59174) |
| ciguatoxin IJKLM ring fragment (CHEBI:61261) is a organic heteropentacyclic compound (CHEBI:38164) |
| ciguatoxin IJKLM ring fragment (CHEBI:61261) is a polycyclic ether (CHEBI:36468) |
| IUPAC Name |
|---|
| (2R,3'S,4'S,4a'R,5a'S,6a'R,8'R,9'S,11'S,12a'S,13a'R,14'S,15'S,15a'S)-9'-(hydroxymethyl)-3',4',11',14'-tetramethyloctadecahydro-3H-spiro[furan-2,2'-pyrano[2'',3'':6',7']oxepino[2',3':5,6]pyrano[3,2-b]oxocine]-8',15'-diol |