EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO2 |
| Net Charge | 0 |
| Average Mass | 247.338 |
| Monoisotopic Mass | 247.15723 |
| SMILES | CCC(=O)C1(c2cccc(O)c2)CCN(C)CC1 |
| InChI | InChI=1S/C15H21NO2/c1-3-14(18)15(7-9-16(2)10-8-15)12-5-4-6-13(17)11-12/h4-6,11,17H,3,7-10H2,1-2H3 |
| InChIKey | ALFGKMXHOUSVAD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Application: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ketobemidone (CHEBI:6125) has role analgesic (CHEBI:35480) |
| Ketobemidone (CHEBI:6125) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| cetobemidona | WHO MedNet |
| Synonyms | Source |
|---|---|
| A 21 lundbeck | ChEMBL |
| cetobemidon | DrugCentral |
| cetobemidone | DrugCentral |
| Ciba 7115 | ChEMBL |
| cliradon | DrugCentral |
| cliradone | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1526 | DrugCentral |
| C11792 | KEGG COMPOUND |
| D08100 | KEGG DRUG |
| HMDB0041913 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:469-79-4 | KEGG COMPOUND |
| Citations |
|---|