EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25NO11 |
| Net Charge | 0 |
| Average Mass | 383.350 |
| Monoisotopic Mass | 383.14276 |
| SMILES | CC(=O)N[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](CO)O[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1b_1-5_2*NCC/3=O][a2112h-1b_1-5]/1-2/a3-b1 |
| InChI | InChI=1S/C14H25NO11/c1-4(18)15-7-12(9(20)6(3-17)24-13(7)23)26-14-11(22)10(21)8(19)5(2-16)25-14/h5-14,16-17,19-23H,2-3H2,1H3,(H,15,18)/t5-,6-,7-,8+,9-,10+,11-,12-,13-,14+/m1/s1 |
| InChIKey | HMQPEDMEOBLSQB-LODBTCKLSA-N |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) has role epitope (CHEBI:53000) |
| β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) is a β-D-Galp-(1→3)-D-GlcpNAc (CHEBI:27707) |
| Incoming Relation(s) |
| 4,6-dideoxy-α-L-xylo-hexopyranosyl-(1→4)-[β-D-Galp-(1→3)]-β-D-GlcpNAc (CHEBI:149135) has functional parent β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| α-D-GalpNAc-(1→3)-β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:148786) has functional parent β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| β-D-Galp-(1→3)-β-D-GlcpNAc-(1→3)-D-Galp (CHEBI:148542) has functional parent β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| β-D-Galp-(1→3)-β-D-GlcpNAc-(1→3)-D-GalNAc-OH (CHEBI:147585) has functional parent β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| β-D-Galp-(1→3)-β-D-GlcpNAc-(1→3)-α-D-GalpNAc (CHEBI:147618) has functional parent β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| β-D-Galp-(1→3)-β-D-GlcpNAc-(1→4)-α-L-Fucp (CHEBI:146984) has functional parent β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| β-D-Galp-(1→3)-β-D-GlcpNAc-(1→6)-D-Galp (CHEBI:148791) has functional parent β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| β-D-galactosyl-(1→3)-N-acetyl-β-D-glucosaminide (CHEBI:133506) has functional parent β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| β-D-galactosyl-(1→3)-N-acetyl-β-D-glucosaminyl group (CHEBI:88144) is substituent group from β-D-Galp-(1→3)-β-D-GlcpNAc (CHEBI:61246) |
| IUPAC Name |
|---|
| β-D-galactopyranosyl-(1→3)-2-acetamido-2-deoxy-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranose | IUPAC |
| Galb1-3GlcNAcb | ChEBI |
| Galβ1-3GIcNAcβ | ChEBI |
| Lec | ChEBI |
| βGal(1-3)βGIcNAc | ChEBI |
| β-D-Gal-(1→3)-β-D-GlcNAc | ChEBI |
| Citations |
|---|