EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2O2S |
| Net Charge | 0 |
| Average Mass | 290.388 |
| Monoisotopic Mass | 290.10890 |
| SMILES | CC(C)(S)[C@H](C(=O)O)n1ccnc1Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2O2S/c1-15(2,20)13(14(18)19)17-9-8-16-12(17)10-11-6-4-3-5-7-11/h3-9,13,20H,10H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | GKKMZZILRVHLJN-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenillamine (CHEBI:61224) has functional parent D-penicillamine (CHEBI:7959) |
| benzylpenillamine (CHEBI:61224) is a imidazoles (CHEBI:24780) |
| benzylpenillamine (CHEBI:61224) is a monocarboxylic acid (CHEBI:25384) |
| benzylpenillamine (CHEBI:61224) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| benzylpenillamine (CHEBI:61224) is a thiol (CHEBI:29256) |
| IUPAC Name |
|---|
| (2S)-2-(2-benzyl-1H-imidazol-1-yl)-3-methyl-3-sulfanylbutanoic acid |
| Synonym | Source |
|---|---|
| D-benzylpenillamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:87115 | Reaxys |
| Citations |
|---|