EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20N2O4S2 |
| Net Charge | 0 |
| Average Mass | 296.414 |
| Monoisotopic Mass | 296.08645 |
| SMILES | CC(C)(SSC(C)(C)[C@@H](N)C(=O)O)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C10H20N2O4S2/c1-9(2,5(11)7(13)14)17-18-10(3,4)6(12)8(15)16/h5-6H,11-12H2,1-4H3,(H,13,14)(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | POYPKGFSZHXASD-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-penicillamine disulfide (CHEBI:61196) is a D-valine derivative (CHEBI:84130) |
| D-penicillamine disulfide (CHEBI:61196) is a organic disulfide (CHEBI:35489) |
| D-penicillamine disulfide (CHEBI:61196) is a sulfur-containing amino acid (CHEBI:26834) |
| IUPAC Name |
|---|
| (2S,2'S)-3,3'-disulfanediylbis(2-amino-3-methylbutanoic acid) |
| Synonyms | Source |
|---|---|
| (2S,2'S)-3,3'-dithiobis(2-amino-3-methylbutanoic acid) | ChEBI |
| (2S,2'S)-3,3'-dithiobis(2-amino-3-methylbutyric acid) | ChEBI |
| 3,3,3,',3'-tetramethyl-D-cystine | ChEBI |
| 3,3'-Dithiodi-D-valine | ChemIDplus |
| S,S'-bi(D-penicillamine) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729013 | Reaxys |
| CAS:20902-45-8 | ChemIDplus |
| Citations |
|---|