EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N5O13P3 |
| Net Charge | 0 |
| Average Mass | 495.171 |
| Monoisotopic Mass | 494.99575 |
| SMILES | Nc1nc2c(c(=O)n1)N=C([C@H](O)[C@@H](O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CN2 |
| InChI | InChI=1S/C9H16N5O13P3/c10-9-13-7-5(8(17)14-9)12-3(1-11-7)6(16)4(15)2-25-29(21,22)27-30(23,24)26-28(18,19)20/h4,6,15-16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H4,10,11,13,14,17)/t4-,6-/m0/s1 |
| InChIKey | DGGUVLXVLHAAGT-NJGYIYPDSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydromonapterin 3-triphosphate (CHEBI:61191) has functional parent L-threo-neopterin (CHEBI:49751) |
| 7,8-dihydromonapterin 3-triphosphate (CHEBI:61191) is a dihydropterin (CHEBI:38797) |
| 7,8-dihydromonapterin 3-triphosphate (CHEBI:61191) is a neopterins (CHEBI:25500) |
| 7,8-dihydromonapterin 3-triphosphate (CHEBI:61191) is a pterin phosphate (CHEBI:36942) |
| 7,8-dihydromonapterin 3-triphosphate (CHEBI:61191) is conjugate acid of 7,8-dihydromonapterin 3-triphosphate(4−) (CHEBI:61186) |
| Incoming Relation(s) |
| 7,8-dihydromonapterin 3-triphosphate(4−) (CHEBI:61186) is conjugate base of 7,8-dihydromonapterin 3-triphosphate (CHEBI:61191) |
| IUPAC Name |
|---|
| (2S,3S)-3-(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)-2,3-dihydroxypropyl tetrahydrogen triphosphate |
| Citations |
|---|