EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N2O2S |
| Net Charge | +1 |
| Average Mass | 383.537 |
| Monoisotopic Mass | 383.17878 |
| SMILES | [H][N+]1(C)CCC[C@@H]1Cc1cnc2ccc(CCS(=O)(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C22H26N2O2S/c1-24-12-5-6-19(24)15-18-16-23-22-10-9-17(14-21(18)22)11-13-27(25,26)20-7-3-2-4-8-20/h2-4,7-10,14,16,19,23H,5-6,11-13,15H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | PWVXXGRKLHYWKM-LJQANCHMSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eletriptan(1+) (CHEBI:61177) is a ammonium ion derivative (CHEBI:35274) |
| eletriptan(1+) (CHEBI:61177) is conjugate acid of eletriptan (CHEBI:50922) |
| Incoming Relation(s) |
| eletriptan hydrobromide (CHEBI:61176) has part eletriptan(1+) (CHEBI:61177) |
| eletriptan (CHEBI:50922) is conjugate base of eletriptan(1+) (CHEBI:61177) |
| IUPAC Name |
|---|
| (2R)-1-methyl-2-({5-[2-(phenylsulfonyl)ethyl]-1H-indol-3-yl}methyl)pyrrolidinium |