EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H75N5O10 |
| Net Charge | 0 |
| Average Mass | 858.131 |
| Monoisotopic Mass | 857.55139 |
| SMILES | CCCCCCCCCCCCCCCCCCCC(=O)N(O)CCCC[C@H](NC(=O)[C@@H]1COC(c2ccccc2O)=N1)C(=O)O[C@H](C)CC(=O)N[C@H]1CCCCN(O)C1=O |
| InChI | InChI=1S/C46H75N5O10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-30-42(54)50(58)31-24-23-28-38(48-43(55)39-34-60-44(49-39)36-26-20-21-29-40(36)52)46(57)61-35(2)33-41(53)47-37-27-22-25-32-51(59)45(37)56/h20-21,26,29,35,37-39,52,58-59H,3-19,22-25,27-28,30-34H2,1-2H3,(H,47,53)(H,48,55)/t35-,37+,38+,39+/m1/s1 |
| InChIKey | FLJNVPAGIYBTDU-XWINOZFQSA-N |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferrimycobactin T (CHEBI:61168) has role siderophore (CHEBI:26672) |
| desferrimycobactin T (CHEBI:61168) is a 1,3-oxazoles (CHEBI:46812) |
| desferrimycobactin T (CHEBI:61168) is a carboxylic ester (CHEBI:33308) |
| desferrimycobactin T (CHEBI:61168) is a cyclic hydroxamic acid (CHEBI:23445) |
| desferrimycobactin T (CHEBI:61168) is a lactam (CHEBI:24995) |
| Incoming Relation(s) |
| mycobactin T:iron (CHEBI:61174) has functional parent desferrimycobactin T (CHEBI:61168) |
| IUPAC Name |
|---|
| (2R)-4-{[(3S)-1-hydroxy-2-oxoazepan-3-yl]amino}-4-oxobutan-2-yl N6-hydroxy-N2-{[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl]carbonyl}-N6-icosanoyl-L-lysinate |
| Synonym | Source |
|---|---|
| desferri-mycobactin T | ChEBI |
| Citations |
|---|