EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | C[C@@H]([NH3+])C(=O)O[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C6H11NO4/c1-3(7)6(10)11-4(2)5(8)9/h3-4H,7H2,1-2H3,(H,8,9)/t3-,4-/m1/s1 |
| InChIKey | QLYOONKPELZQGZ-QWWZWVQMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-alanyl-(R)-lactic acid zwitterion (CHEBI:61166) is a zwitterion (CHEBI:27369) |
| D-alanyl-(R)-lactic acid zwitterion (CHEBI:61166) is tautomer of D-alanyl-(R)-lactic acid (CHEBI:61163) |
| Incoming Relation(s) |
| D-alanyl-(R)-lactic acid (CHEBI:61163) is tautomer of D-alanyl-(R)-lactic acid zwitterion (CHEBI:61166) |
| IUPAC Name |
|---|
| (2R)-2-{[(2R)-2-ammoniopropanoyl]oxy}propanoate |
| Synonyms | Source |
|---|---|
| (2R)-2-(D-alanyloxy)propanoic acid zwitterion | ChEBI |
| (2R)-2-(D-alanyloxy)propionic acid zwitterion | ChEBI |
| alanyllactate zwitterion | ChEBI |
| (R)-2-((R)-2-aminopropanoyloxy)propanoic acid zwitterion | ChEBI |
| (R)-2-((R)-2-aminopropanoyloxy)propionic acid zwitterion | ChEBI |
| (R)-alanyl-(R)-lactic acid zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| D-alanyl-(R)-lactate | UniProt |