EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H49N5O12 |
| Net Charge | 0 |
| Average Mass | 719.789 |
| Monoisotopic Mass | 719.33777 |
| SMILES | COC(=O)CCCCCC(=O)N(O)CCCCC(NC(=O)C1COC(c2ccccc2O)=N1)C(=O)OC(C)CC(=O)NC1CCCCN(O)C1=O |
| InChI | InChI=1S/C34H49N5O12/c1-22(20-28(41)35-24-13-8-11-19-39(48)33(24)45)51-34(46)25(14-9-10-18-38(47)29(42)16-4-3-5-17-30(43)49-2)36-31(44)26-21-50-32(37-26)23-12-6-7-15-27(23)40/h6-7,12,15,22,24-26,40,47-48H,3-5,8-11,13-14,16-21H2,1-2H3,(H,35,41)(H,36,44) |
| InChIKey | CICZEXPNYSZNEI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desferriexochelin 772MS (CHEBI:61152) has role siderophore (CHEBI:26672) |
| desferriexochelin 772MS (CHEBI:61152) is a 1,3-oxazoles (CHEBI:46812) |
| desferriexochelin 772MS (CHEBI:61152) is a cyclic hydroxamic acid (CHEBI:23445) |
| desferriexochelin 772MS (CHEBI:61152) is a lactam (CHEBI:24995) |
| desferriexochelin 772MS (CHEBI:61152) is a methyl ester (CHEBI:25248) |
| Incoming Relation(s) |
| exochelin 772SM (CHEBI:61167) has functional parent desferriexochelin 772MS (CHEBI:61152) |
| IUPAC Name |
|---|
| methyl 7-{hydroxy[6-({4-[(1-hydroxy-2-oxoazepan-3-yl)amino]-4-oxobutan-2-yl}oxy)-5-({[2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl]carbonyl}amino)-6-oxohexyl]amino}-7-oxoheptanoate |
| Synonym | Source |
|---|---|
| desferri-exochelin 772MS | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US5786326 | Patent |
| Citations |
|---|