EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30FeN4O10 |
| Net Charge | 0 |
| Average Mass | 710.477 |
| Monoisotopic Mass | 710.13113 |
| SMILES | Cc1c(CCC(=O)O)c2[n]3c1C=C1C(=O)[C@](C)(CC(=O)O)C4=[N+]1[Fe-2]31[n]3c(c(C)c(/C=C/C(=O)O)c3=C2)=CC2=[N+]1C(=C4)C(=O)[C@]2(C)CC(=O)O |
| InChI | InChI=1S/C34H32N4O10.Fe/c1-15-17(5-7-27(39)40)21-10-22-18(6-8-28(41)42)16(2)20(36-22)11-25-33(3,13-29(43)44)32(48)24(38-25)12-26-34(4,14-30(45)46)31(47)23(37-26)9-19(15)35-21;/h6,8-12H,5,7,13-14H2,1-4H3,(H6,35,36,37,38,39,40,41,42,43,44,45,46,47,48);/q;+2/p-2/b8-6+;/t33-,34-;/m1./s1 |
| InChIKey | YTCKFKAUGWIMPJ-FSQDTXDGSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferroheme d1 (CHEBI:61147) is a diketone (CHEBI:46640) |
| ferroheme d1 (CHEBI:61147) is a ferroheme (CHEBI:38573) |
| ferroheme d1 (CHEBI:61147) is a metallochlorin (CHEBI:62804) |
| ferroheme d1 (CHEBI:61147) is a tetracarboxylic acid (CHEBI:35742) |
| ferroheme d1 (CHEBI:61147) is conjugate acid of ferroheme d1(4−) (CHEBI:60549) |
| Incoming Relation(s) |
| ferroheme d1(4−) (CHEBI:60549) is conjugate base of ferroheme d1 (CHEBI:61147) |
| IUPAC Names |
|---|
| {3-[18-(2-carboxyethyl)-7,12-bis(carboxymethyl)-3,7,12,17-tetramethyl-8,13-dioxo-7,8,12,13-tetrahydroporphyrin-2-yl--κ4N21,N22,N23,N24]acrylato(2−)}iron |
| [(2E)-3-[(7R,12R)-18-(2-carboxyethyl)-7,12-bis(carboxymethyl)-3,7,12,17-tetramethyl-8,13-dioxo-7,8,12,13-tetrahydroporphyrin-2-yl-κ4N21,N22,N23,N24]prop-2-enoato(2−)]iron |
| Synonyms | Source |
|---|---|
| heme d1 | ChEBI |
| haem d1 | ChEBI |
| dioneheme | ChEBI |
| Citations |
|---|