EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO4 |
| Net Charge | 0 |
| Average Mass | 149.146 |
| Monoisotopic Mass | 149.06881 |
| SMILES | CC(C)[C@@H](C(=O)O)N(O)O |
| InChI | InChI=1S/C5H11NO4/c1-3(2)4(5(7)8)6(9)10/h3-4,9-10H,1-2H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | VWRMUTKBDQWLAX-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxy-L-valine (CHEBI:61141) is a N,N-dihydroxy-α-amino acid (CHEBI:50766) |
| N,N-dihydroxy-L-valine (CHEBI:61141) is a L-valine derivative (CHEBI:84129) |
| N,N-dihydroxy-L-valine (CHEBI:61141) is conjugate acid of N,N-dihydroxy-L-valinate (CHEBI:61142) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-valinate (CHEBI:61142) is conjugate base of N,N-dihydroxy-L-valine (CHEBI:61141) |
| IUPAC Name |
|---|
| N,N-dihydroxy-L-valine |