EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3 |
| Net Charge | 0 |
| Average Mass | 133.147 |
| Monoisotopic Mass | 133.07389 |
| SMILES | CC(C)[C@H](NO)C(=O)O |
| InChI | InChI=1S/C5H11NO3/c1-3(2)4(6-9)5(7)8/h3-4,6,9H,1-2H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | PXEKBQAJOBYINU-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei brucei (ncbitaxon:5702) | |||
| - | PubMed (23571546) | Strain: WT427 | |
| - | MetaboLights (MTBLS49) | Strain: WT427 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-L-valine (CHEBI:61138) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| N-hydroxy-L-valine (CHEBI:61138) is a hydroxy-L-valine (CHEBI:61139) |
| N-hydroxy-L-valine (CHEBI:61138) is a hydroxylamines (CHEBI:24709) |
| N-hydroxy-L-valine (CHEBI:61138) is conjugate acid of N-hydroxy-L-valinate (CHEBI:61140) |
| Incoming Relation(s) |
| N-hydroxy-L-valinate (CHEBI:61140) is conjugate base of N-hydroxy-L-valine (CHEBI:61138) |
| IUPAC Name |
|---|
| N-hydroxy-L-valine |
| Synonym | Source |
|---|---|
| N-hydroxyvaline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6588754 | Reaxys |