EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO4 |
| Net Charge | 0 |
| Average Mass | 163.173 |
| Monoisotopic Mass | 163.08446 |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N(O)O |
| InChI | InChI=1S/C6H13NO4/c1-3-4(2)5(6(8)9)7(10)11/h4-5,10-11H,3H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 |
| InChIKey | SCCQCCCXSLYFHJ-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxy-L-isoleucine (CHEBI:61132) is a N,N-dihydroxy-α-amino acid (CHEBI:50766) |
| N,N-dihydroxy-L-isoleucine (CHEBI:61132) is a L-isoleucine derivative (CHEBI:84111) |
| N,N-dihydroxy-L-isoleucine (CHEBI:61132) is conjugate acid of N,N-dihydroxy-L-isoleucinate (CHEBI:61133) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-isoleucinate (CHEBI:61133) is conjugate base of N,N-dihydroxy-L-isoleucine (CHEBI:61132) |
| IUPAC Name |
|---|
| N,N-dihydroxy-L-isoleucine |