EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6N4O3 |
| Net Charge | 0 |
| Average Mass | 194.150 |
| Monoisotopic Mass | 194.04399 |
| SMILES | Nc1nc(=O)c2c(C(=O)O)cnc2n1 |
| InChI | InChI=1S/C7H6N4O3/c8-7-10-4-3(5(12)11-7)2(1-9-4)6(13)14/h1H,(H,13,14)(H4,8,9,10,11,12) |
| InChIKey | XIUIRSLBMMTDSK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-carboxy-7-deazaguanine (CHEBI:61125) is a monocarboxylic acid (CHEBI:25384) |
| 7-carboxy-7-deazaguanine (CHEBI:61125) is a pyrrolopyrimidine (CHEBI:38670) |
| 7-carboxy-7-deazaguanine (CHEBI:61125) is conjugate acid of 7-carboxylato-7-deazaguanine (CHEBI:61036) |
| Incoming Relation(s) |
| 7-amido-7-deazaguanosine (CHEBI:131836) has functional parent 7-carboxy-7-deazaguanine (CHEBI:61125) |
| 7-cyano-7-deazaguanine (CHEBI:45075) has functional parent 7-carboxy-7-deazaguanine (CHEBI:61125) |
| 7-formamidino-7-deazaguanine (CHEBI:64686) has functional parent 7-carboxy-7-deazaguanine (CHEBI:61125) |
| 7-carboxylato-7-deazaguanine (CHEBI:61036) is conjugate base of 7-carboxy-7-deazaguanine (CHEBI:61125) |
| IUPAC Name |
|---|
| 2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
| Synonym | Source |
|---|---|
| 7-deaza-7-carboxyguanine | ChEBI |
| Citations |
|---|