EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O3 |
| Net Charge | 0 |
| Average Mass | 274.360 |
| Monoisotopic Mass | 274.15689 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C17H22O3/c1-12(2)5-4-6-13(3)7-8-14-11-15(17(19)20)9-10-16(14)18/h5,7,9-11,18H,4,6,8H2,1-3H3,(H,19,20)/b13-7+ |
| InChIKey | HKIMBCGCVPYUTJ-NTUHNPAUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-geranyl-4-hydroxybenzoic acid (CHEBI:61122) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-geranyl-4-hydroxybenzoic acid (CHEBI:61122) is conjugate acid of 3-geranyl-4-hydroxybenzoate(1−) (CHEBI:60878) |
| Incoming Relation(s) |
| 3-geranyl-4-hydroxybenzoate(1−) (CHEBI:60878) is conjugate base of 3-geranyl-4-hydroxybenzoic acid (CHEBI:61122) |
| IUPAC Name |
|---|
| 3-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-4-hydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| C18131 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2853541 | Reaxys |
| Citations |
|---|