EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | Cc1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C10H10O2/c1-8-3-2-4-9(7-8)5-6-10(11)12/h2-7H,1H3,(H,11,12)/b6-5+ |
| InChIKey | JZINNAKNHHQBOS-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylcinnamic acid (CHEBI:61118) is a cinnamic acids (CHEBI:23252) |
| Incoming Relation(s) |
| 3-methylcinnamoyl group (CHEBI:60676) is substituent group from 3-methylcinnamic acid (CHEBI:61118) |
| IUPAC Name |
|---|
| (2E)-3-(3-methylphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2E)-3-(3-Methylphenyl)-2-propenoic acid | NIST Chemistry WebBook |
| (2E)-3-(3-methylphenyl)acrylic acid | IUPAC |
| m-Methylcinnamic acid | ChemIDplus |