EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O3 |
| Net Charge | 0 |
| Average Mass | 380.488 |
| Monoisotopic Mass | 380.20999 |
| SMILES | O=C(O)CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N2O3/c26-22(11-12-23(27)28)25(20-9-5-2-6-10-20)21-14-17-24(18-15-21)16-13-19-7-3-1-4-8-19/h1-10,21H,11-18H2,(H,27,28) |
| InChIKey | MEVFKTVEGJUHHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboxyfentanyl (CHEBI:61106) has functional parent succinic acid (CHEBI:15741) |
| carboxyfentanyl (CHEBI:61106) is a dicarboxylic acid monoamide (CHEBI:35735) |
| carboxyfentanyl (CHEBI:61106) is a monocarboxylic acid (CHEBI:25384) |
| carboxyfentanyl (CHEBI:61106) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 4-oxo-4-{phenyl[1-(2-phenylethyl)piperidin-4-yl]amino}butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| US7109310 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11245147 | Reaxys |
| Citations |
|---|