EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O14 |
| Net Charge | 0 |
| Average Mass | 460.429 |
| Monoisotopic Mass | 460.17921 |
| SMILES | C[C@@H]1O[C@@H](O[C@H](CO)[C@@H](O)[C@@H](O)CO)[C@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]1O |
| WURCS | WURCS=2.0/3,3,2/[h222h][a2211m-1a_1-5][a2122h-1a_1-5]/1-2-3/a4-b1_b3-c1 |
| InChI | InChI=1S/C17H32O14/c1-5-9(22)15(31-16-13(26)12(25)11(24)8(4-20)30-16)14(27)17(28-5)29-7(3-19)10(23)6(21)2-18/h5-27H,2-4H2,1H3/t5-,6-,7+,8+,9-,10-,11+,12-,13+,14+,15+,16+,17-/m0/s1 |
| InChIKey | XNJHZUWZWZAAHY-UXAVWGNNSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-Glcp-(1→3)-α-L-Rhap-(1→4)-D-ribitol (CHEBI:61100) has functional parent ribitol (CHEBI:15963) |
| α-D-Glcp-(1→3)-α-L-Rhap-(1→4)-D-ribitol (CHEBI:61100) has role hapten (CHEBI:59174) |
| α-D-Glcp-(1→3)-α-L-Rhap-(1→4)-D-ribitol (CHEBI:61100) is a glycoside (CHEBI:24400) |
| α-D-Glcp-(1→3)-α-L-Rhap-(1→4)-D-ribitol (CHEBI:61100) is a trisaccharide (CHEBI:27150) |
| IUPAC Name |
|---|
| α-D-glucopyranosyl-(1→3)-α-L-rhamnopyranosyl-(1→4)-D-ribitol |
| Synonyms | Source |
|---|---|
| α-D-Glc-(1→3)-α-L-Rha-(1→4)-D-ribitol | ChEBI |
| α-D-glucopyranosyl-(1→3)-6-deoxy-α-L-mannopyranosyl-(1→4)-D-ribitol | IUPAC |
| α-D-glucosyl-(1→3)-α-L-rhamnosyl-(1→4)-D-ribitol | ChEBI |
| Citations |
|---|