EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2OS |
| Net Charge | 0 |
| Average Mass | 342.508 |
| Monoisotopic Mass | 342.17658 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C20H26N2OS/c1-2-20(23)22(17-7-4-3-5-8-17)18-10-13-21(14-11-18)15-12-19-9-6-16-24-19/h3-9,16,18H,2,10-15H2,1H3 |
| InChIKey | YMRFZDHYDKZXPA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thienylfentanyl (CHEBI:61099) has role opioid analgesic (CHEBI:35482) |
| thienylfentanyl (CHEBI:61099) has role μ-opioid receptor agonist (CHEBI:55322) |
| thienylfentanyl (CHEBI:61099) is a anilide (CHEBI:13248) |
| thienylfentanyl (CHEBI:61099) is a piperidines (CHEBI:26151) |
| thienylfentanyl (CHEBI:61099) is a tertiary amino compound (CHEBI:50996) |
| thienylfentanyl (CHEBI:61099) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N-phenyl-N-{1-[2-(2-thienyl)ethyl]piperidin-4-yl}propanamide |
| Synonyms | Source |
|---|---|
| N-(1-(β-(2-thienyl)ethyl)-4-piperidyl)propioanilide | ChemIDplus |
| N-phenyl-N-[1-[2-(2-thienyl)ethyl]-4-piperidinyl]propanamide | ChEBI |
| N-phenyl-N-(1-((2-thienyl)ethyl)-4-piperidinyl)propanamide | ChemIDplus |
| thienylfentanil | ChEBI |
| thiofentanyl | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C22739 | KEGG COMPOUND |
| DB09180 | DrugBank |
| Thiofentanyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:495808 | Reaxys |
| CAS:1165-22-6 | KEGG COMPOUND |
| Citations |
|---|