EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22O9 |
| Net Charge | 0 |
| Average Mass | 298.288 |
| Monoisotopic Mass | 298.12638 |
| SMILES | C[C@@H]1O[C@@H](O[C@H](CO)[C@@H](O)[C@@H](O)CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H22O9/c1-4-7(15)9(17)10(18)11(19-4)20-6(3-13)8(16)5(14)2-12/h4-18H,2-3H2,1H3/t4-,5-,6+,7-,8-,9+,10+,11-/m0/s1 |
| InChIKey | GRXCPUQXHLJXLQ-WFSGIGAVSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-Rhap-(1→4)-D-ribitol (CHEBI:61097) has functional parent ribitol (CHEBI:15963) |
| α-L-Rhap-(1→4)-D-ribitol (CHEBI:61097) has role hapten (CHEBI:59174) |
| α-L-Rhap-(1→4)-D-ribitol (CHEBI:61097) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| α-L-rhamnopyranosyl-(1→4)-D-ribitol |
| Synonyms | Source |
|---|---|
| 4-O-(6-deoxy-α-L-mannopyranosyl)-D-ribitol | IUPAC |
| 4-O-(α-L-Rhap)-D-ribitol | ChEBI |
| 4-O-(α-L-rhamnopyranosyl)-D-ribitol | IUPAC |
| 6-deoxy-α-L-mannopyranosyl-(1→4)-D-ribitol | IUPAC |
| α-L-rhamnosyl-(1→4)-D-ribitol | ChEBI |
| Citations |
|---|