EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N2O3 |
| Net Charge | 0 |
| Average Mass | 408.542 |
| Monoisotopic Mass | 408.24129 |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCc2ccccc2)CC1C |
| InChI | InChI=1S/C25H32N2O3/c1-4-23(28)27(22-13-9-6-10-14-22)25(24(29)30-3)16-18-26(19-20(25)2)17-15-21-11-7-5-8-12-21/h5-14,20H,4,15-19H2,1-3H3 |
| InChIKey | IMYHGORQCPYVBZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lofentanyl (CHEBI:61095) has role opioid analgesic (CHEBI:35482) |
| lofentanyl (CHEBI:61095) has role μ-opioid receptor agonist (CHEBI:55322) |
| lofentanyl (CHEBI:61095) is a methyl ester (CHEBI:25248) |
| lofentanyl (CHEBI:61095) is a piperidines (CHEBI:26151) |
| lofentanyl (CHEBI:61095) is a tertiary amino compound (CHEBI:50996) |
| lofentanyl (CHEBI:61095) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| methyl 3-methyl-1-(2-phenylethyl)-4-[phenyl(propionyl)amino]piperidine-4-carboxylate |
| Registry Numbers | Sources |
|---|---|
| CAS:60645-00-3 | ChemIDplus |
| Citations |
|---|