EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N2O |
| Net Charge | 0 |
| Average Mass | 350.506 |
| Monoisotopic Mass | 350.23581 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1C |
| InChI | InChI=1S/C23H30N2O/c1-3-23(26)25(21-12-8-5-9-13-21)22-15-17-24(18-19(22)2)16-14-20-10-6-4-7-11-20/h4-13,19,22H,3,14-18H2,1-2H3 |
| InChIKey | MLQRZXNZHAOCHQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylfentanyl (CHEBI:61092) has role opioid analgesic (CHEBI:35482) |
| 3-methylfentanyl (CHEBI:61092) has role sedative (CHEBI:35717) |
| 3-methylfentanyl (CHEBI:61092) has role μ-opioid receptor agonist (CHEBI:55322) |
| 3-methylfentanyl (CHEBI:61092) is a anilide (CHEBI:13248) |
| 3-methylfentanyl (CHEBI:61092) is a monocarboxylic acid amide (CHEBI:29347) |
| 3-methylfentanyl (CHEBI:61092) is a piperidines (CHEBI:26151) |
| 3-methylfentanyl (CHEBI:61092) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[3-methyl-1-(2-phenylethyl)piperidin-4-yl]-N-phenylpropanamide |
| Synonyms | Source |
|---|---|
| 3-MF | DrugBank |
| N-(3-methyl-1-(2-phenylethyl)-4-piperidinyl)-N-phenylpropanamide | ChemIDplus |
| mefentanyl | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 3-Methylfentanyl | Wikipedia |
| C22793 | KEGG COMPOUND |
| DB01571 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:495141 | Reaxys |
| CAS:42045-86-3 | ChemIDplus |
| CAS:42045-86-3 | NIST Chemistry WebBook |
| Citations |
|---|