EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36N4O11.H2O4S |
| Net Charge | 0 |
| Average Mass | 582.582 |
| Monoisotopic Mass | 582.20544 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H](N)C[C@@H]2N)[C@H](O)[C@@H](O)[C@@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C18H36N4O11.H2O4S/c19-2-6-10(25)12(27)13(28)18(30-6)33-16-5(21)1-4(20)15(14(16)29)32-17-11(26)8(22)9(24)7(3-23)31-17;1-5(2,3)4/h4-18,23-29H,1-3,19-22H2;(H2,1,2,3,4)/t4-,5+,6-,7-,8+,9-,10-,11-,12+,13-,14-,15+,16-,17-,18-;/m1./s1 |
| InChIKey | OOYGSFOGFJDDHP-KMCOLRRFSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kanamycin A sulfate (CHEBI:6109) has part kanamycin A (CHEBI:17630) |
| kanamycin A sulfate (CHEBI:6109) has role antibacterial drug (CHEBI:36047) |
| kanamycin A sulfate (CHEBI:6109) has role geroprotector (CHEBI:176497) |
| kanamycin A sulfate (CHEBI:6109) is a aminoglycoside sulfate salt (CHEBI:38012) |
| Synonyms | Source |
|---|---|
| Kanamycin acid sulfate | ChemIDplus |
| Kanamycin A sulfate | ChemIDplus |
| Kanamycin monosulfate | KEGG COMPOUND |
| Kanamycin sulfate | KEGG COMPOUND |
| Kantrex | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3874279 | Beilstein |
| CAS:25389-94-0 | KEGG COMPOUND |
| CAS:25389-94-0 | ChemIDplus |
| Citations |
|---|