EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O2 |
| Net Charge | 0 |
| Average Mass | 194.274 |
| Monoisotopic Mass | 194.13068 |
| SMILES | CCCCCc1cc(O)cc(O)c1C |
| InChI | InChI=1S/C12H18O2/c1-3-4-5-6-10-7-11(13)8-12(14)9(10)2/h7-8,13-14H,3-6H2,1-2H3 |
| InChIKey | CUXFFBBWEJOYAI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-5-pentylbenzene-1,3-diol (CHEBI:61089) has role antineoplastic agent (CHEBI:35610) |
| 4-methyl-5-pentylbenzene-1,3-diol (CHEBI:61089) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 4-methyl-5-pentylbenzene-1,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10668241 | Reaxys |
| Citations |
|---|