EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N2O3 |
| Net Charge | 0 |
| Average Mass | 394.515 |
| Monoisotopic Mass | 394.22564 |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-3-22(27)26(21-12-8-5-9-13-21)24(23(28)29-2)15-18-25(19-16-24)17-14-20-10-6-4-7-11-20/h4-13H,3,14-19H2,1-2H3 |
| InChIKey | YDSDEBIZUNNPOB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | tranquilizing drug A traditional grouping of drugs said to have a soothing or calming effect on mood, thought or behaviour. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carfentanil (CHEBI:61084) has role opioid analgesic (CHEBI:35482) |
| carfentanil (CHEBI:61084) has role tranquilizing drug (CHEBI:35473) |
| carfentanil (CHEBI:61084) has role μ-opioid receptor agonist (CHEBI:55322) |
| carfentanil (CHEBI:61084) is a anilide (CHEBI:13248) |
| carfentanil (CHEBI:61084) is a methyl ester (CHEBI:25248) |
| carfentanil (CHEBI:61084) is a piperidines (CHEBI:26151) |
| carfentanil (CHEBI:61084) is a tertiary amino compound (CHEBI:50996) |
| carfentanil (CHEBI:61084) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| methyl 1-(2-phenylethyl)-4-[phenyl(propionyl)amino]piperidine-4-carboxylate |
| INNs | Source |
|---|---|
| carfentanil | WHO MedNet |
| carfentanil | WHO MedNet |
| carfentanilo | WHO MedNet |
| carfentanilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-((1-Oxopropyl)phenylamino)-1-(2-phenylethyl)-4-piperidinecarboxylic acid methyl ester | ChemIDplus |
| carfentanyl | ChemIDplus |
| Methyl 1-phenylethyl-4-(N-phenylpropionamido)isonipecotate | ChemIDplus |
| Methyl 4-(N-(1-oxopropyl)-N-phenylamino)-1-(2-phenylethyl)-4-piperidinecarboxylate | ChemIDplus |
| Methyl 4-(N-propionyl-N-phenylamino)-1-(2-phenylethyl)-4-piperidine-carboxylate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Wildnil | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| Carfentanil | Wikipedia |
| D07620 | KEGG DRUG |
| DB01535 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:456976 | Reaxys |
| CAS:59708-52-0 | ChemIDplus |
| Citations |
|---|