EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36N4O6S2 |
| Net Charge | 0 |
| Average Mass | 540.708 |
| Monoisotopic Mass | 540.20763 |
| SMILES | C/C=C1\NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@H](C(C)C)C(=O)N2)OC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C24H36N4O6S2/c1-6-16-21(30)28-20(14(4)5)24(33)34-15-9-7-8-10-35-36-12-17(22(31)25-16)26-23(32)19(13(2)3)27-18(29)11-15/h6-7,9,13-15,17,19-20H,8,10-12H2,1-5H3,(H,25,31)(H,26,32)(H,27,29)(H,28,30)/b9-7+,16-6-/t15-,17-,19-,20+/m1/s1 |
| InChIKey | OHRURASPPZQGQM-GCCNXGTGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chromobacterium violaceum (ncbitaxon:536) | |||
| - | PubMed (21793558) | Strain: 968 | |
| - | PubMed (21967146) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| romidepsin (CHEBI:61080) has role antineoplastic agent (CHEBI:35610) |
| romidepsin (CHEBI:61080) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| romidepsin (CHEBI:61080) is a cyclodepsipeptide (CHEBI:35213) |
| romidepsin (CHEBI:61080) is a heterocyclic antibiotic (CHEBI:24531) |
| romidepsin (CHEBI:61080) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| (1S,4S,7Z,10S,16E,21R)-7-ethylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20,23-tetraazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
| INNs | Source |
|---|---|
| romidepsin | ChemIDplus |
| romidepsina | WHO MedNet |
| romidepsine | WHO MedNet |
| romidepsinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Antibiotic FR 901228 | ChemIDplus |
| FK228 | SUBMITTER |
| FR901228 | SUBMITTER |
| NSC-630176 | ChEBI |
| Brand Names | Source |
|---|---|
| Chromadax | KEGG DRUG |
| Istodax | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 4119 | DrugCentral |
| D06637 | KEGG DRUG |
| Romidepsin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6854221 | Reaxys |
| CAS:128517-07-7 | SUBMITTER |
| CAS:128517-07-7 | KEGG DRUG |
| CAS:128517-07-7 | ChemIDplus |
| Citations |
|---|