EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27FN2O |
| Net Charge | 0 |
| Average Mass | 354.469 |
| Monoisotopic Mass | 354.21074 |
| SMILES | CCC(=O)N(c1ccc(F)cc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27FN2O/c1-2-22(26)25(20-10-8-19(23)9-11-20)21-13-16-24(17-14-21)15-12-18-6-4-3-5-7-18/h3-11,21H,2,12-17H2,1H3 |
| InChIKey | KXUBAVLIJFTASZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-fluorofentanyl (CHEBI:61074) has role opioid analgesic (CHEBI:35482) |
| 4-fluorofentanyl (CHEBI:61074) has role μ-opioid receptor agonist (CHEBI:55322) |
| 4-fluorofentanyl (CHEBI:61074) is a monocarboxylic acid amide (CHEBI:29347) |
| 4-fluorofentanyl (CHEBI:61074) is a monofluorobenzenes (CHEBI:83575) |
| 4-fluorofentanyl (CHEBI:61074) is a piperidines (CHEBI:26151) |
| 4-fluorofentanyl (CHEBI:61074) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(4-fluorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| Synonyms | Source |
|---|---|
| N-(4-fluorophenyl)-N-[1-(2-phenylethyl)-4-piperidinyl]propanamide | ChEBI |
| para-fluorofentanyl | ChEBI |
| p-fluorofentanyl | ChEBI |
| N-(4-Fluorophenyl)-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide | ChemIDplus |
| parafluorofentanyl | DrugBank |
| pFF | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB09177 | DrugBank |
| HMDB0256037 | HMDB |
| Parafluorofentanyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4713884 | Reaxys |
| CAS:90736-23-5 | ChEBI |
| Citations |
|---|