EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13F3N2O3 |
| Net Charge | 0 |
| Average Mass | 242.197 |
| Monoisotopic Mass | 242.08783 |
| SMILES | N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H13F3N2O3/c9-8(10,11)7(16)13-4-2-1-3-5(12)6(14)15/h5H,1-4,12H2,(H,13,16)(H,14,15)/t5-/m0/s1 |
| InChIKey | PZZHRSVBHRVIMI-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-trifluoroacetyl-L-lysine (CHEBI:61064) is a N6-acyl-L-lysine (CHEBI:16232) |
| N6-trifluoroacetyl-L-lysine (CHEBI:61064) is a secondary carboxamide (CHEBI:140325) |
| N6-trifluoroacetyl-L-lysine (CHEBI:61064) is a trifluoroacetamide (CHEBI:145723) |
| IUPAC Name |
|---|
| N6-(trifluoroacetyl)-L-lysine |
| Synonym | Source |
|---|---|
| N6-(Trifluoroacetyl)-L-lysine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2122429 | Reaxys |
| CAS:10009-20-8 | ChemIDplus |
| Citations |
|---|