EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O3 |
| Net Charge | 0 |
| Average Mass | 202.254 |
| Monoisotopic Mass | 202.13174 |
| SMILES | CC(=O)CNCCCCC(N)C(=O)O |
| InChI | InChI=1S/C9H18N2O3/c1-7(12)6-11-5-3-2-4-8(10)9(13)14/h8,11H,2-6,10H2,1H3,(H,13,14) |
| InChIKey | HHNPKRUVIGOOII-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-acetonyllysine (CHEBI:61061) is a lysine derivative (CHEBI:53079) |
| N6-acetonyllysine (CHEBI:61061) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| N6-(2-oxopropyl)lysine |
| Synonym | Source |
|---|---|
| Nε-acetonyllysine | ChEBI |
| Citations |
|---|