EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H53N3O49S8 |
| Net Charge | 0 |
| Average Mass | 1508.273 |
| Monoisotopic Mass | 1506.95133 |
| SMILES | CO[C@H]1O[C@H](COS(=O)(=O)O)[C@@H](O[C@@H]2O[C@@H](C(=O)O)[C@@H](O[C@H]3O[C@H](COS(=O)(=O)O)[C@@H](O[C@@H]4O[C@H](C(=O)O)[C@@H](O[C@H]5O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]5NS(=O)(=O)O)[C@H](O)[C@H]4O)[C@H](OS(=O)(=O)O)[C@H]3NS(=O)(=O)O)[C@H](O)[C@H]2OS(=O)(=O)O)[C@H](O)[C@H]1NS(=O)(=O)O |
| InChI | InChI=1S/C31H53N3O49S8/c1-69-27-9(33-85(48,49)50)13(37)17(6(74-27)3-71-88(57,58)59)76-31-22(83-91(66,67)68)16(40)21(24(81-31)26(43)44)79-29-10(34-86(51,52)53)19(82-90(63,64)65)18(7(75-29)4-72-89(60,61)62)77-30-15(39)14(38)20(23(80-30)25(41)42)78-28-8(32-84(45,46)47)12(36)11(35)5(73-28)2-70-87(54,55)56/h5-24,27-40H,2-4H2,1H3,(H,41,42)(H,43,44)(H,45,46,47)(H,48,49,50)(H,51,52,53)(H,54,55,56)(H,57,58,59)(H,60,61,62)(H,63,64,65)(H,66,67,68)/t5-,6-,7-,8-,9-,10-,11-,12-,13-,14-,15-,16+,17-,18-,19-,20+,21+,22-,23+,24-,27+,28-,29-,30-,31-/m1/s1 |
| InChIKey | KANJSNBRCNMZMV-ABRZTLGGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. anticoagulant An agent that prevents blood clotting. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fondaparinux (CHEBI:61033) has functional parent normethylfondaparinux (CHEBI:145599) |
| fondaparinux (CHEBI:61033) has role anti-arrhythmia drug (CHEBI:38070) |
| fondaparinux (CHEBI:61033) has role anti-obesity agent (CHEBI:74518) |
| fondaparinux (CHEBI:61033) has role anticoagulant (CHEBI:50249) |
| fondaparinux (CHEBI:61033) has role antineoplastic agent (CHEBI:35610) |
| fondaparinux (CHEBI:61033) has role antiviral agent (CHEBI:22587) |
| fondaparinux (CHEBI:61033) has role cardiovascular drug (CHEBI:35554) |
| fondaparinux (CHEBI:61033) is a amino sugar (CHEBI:28963) |
| fondaparinux (CHEBI:61033) is a oligosaccharide sulfate (CHEBI:37909) |
| fondaparinux (CHEBI:61033) is a pentasaccharide derivative (CHEBI:63566) |
| fondaparinux (CHEBI:61033) is conjugate acid of fondaparinux(10−) (CHEBI:61038) |
| Incoming Relation(s) |
| fondaparinux(10−) (CHEBI:61038) is conjugate base of fondaparinux (CHEBI:61033) |
| IUPAC Name |
|---|
| methyl 2-deoxy-6-O-sulfo-2-(sulfoamino)-α-D-glucopyranosyl-(1→4)-β-D-glucopyranuronosyl-(1→4)-2-deoxy-3,6-di-O-sulfo-2-(sulfoamino)-α-D-glucopyranosyl-(1→4)-2-O-sulfo-α-L-idopyranuronosyl-(1→4)-2-deoxy-6-O-sulfo-2-(sulfoamino)-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| fondaparin | DrugCentral |
| Fondaparinux | ChEMBL |
| Natural heparin pentasaccharide | ChemIDplus |
| ORG-31540 FREE ACID | ChEMBL |
| ORG31540 FREE ACID | ChEMBL |
| SR 901107A | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1236 | DrugCentral |
| Fondaparinux | Wikipedia |
| NTO | PDBeChem |
| PPR103739 | PPR |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9381701 | Reaxys |
| CAS:104993-28-4 | ChemIDplus |
| Citations |
|---|