EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32N4O8 |
| Net Charge | 0 |
| Average Mass | 432.474 |
| Monoisotopic Mass | 432.22201 |
| SMILES | O=C(O)CN1CCCN(CC(=O)O)CCN(CC(=O)O)CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H32N4O8/c23-15(24)11-19-3-1-4-20(12-16(25)26)8-10-22(14-18(29)30)6-2-5-21(9-7-19)13-17(27)28/h1-14H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | JVHROZDXPAUZFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TETA (CHEBI:61030) has parent hydride 1,4,8,11-tetraazacyclotetradecane (CHEBI:37401) |
| TETA (CHEBI:61030) has role chelator (CHEBI:38161) |
| TETA (CHEBI:61030) has role copper chelator (CHEBI:166831) |
| TETA (CHEBI:61030) is a azamacrocycle (CHEBI:52898) |
| IUPAC Name |
|---|
| 2,2',2'',2'''-(1,4,8,11-tetraazacyclotetradecane-1,4,8,11-tetrayl)tetraacetic acid |
| Synonym | Source |
|---|---|
| 1,4,8,11-tetraazacyclotetradecane-N,N',N'',N'''-tetraacetic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:60239-22-7 | ChEBI |
| Citations |
|---|