EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28N4O8 |
| Net Charge | 0 |
| Average Mass | 404.420 |
| Monoisotopic Mass | 404.19071 |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H28N4O8/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | WDLRUFUQRNWCPK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DOTA (CHEBI:61028) has parent hydride 1,4,7,10-tetraazacyclododecane (CHEBI:37391) |
| DOTA (CHEBI:61028) has role chelator (CHEBI:38161) |
| DOTA (CHEBI:61028) has role copper chelator (CHEBI:166831) |
| DOTA (CHEBI:61028) is a azamacrocycle (CHEBI:52898) |
| Incoming Relation(s) |
| (S)-2-(4-(2-bromoacetamido)benzyl)-DOTA (CHEBI:63643) has functional parent DOTA (CHEBI:61028) |
| (S)-2-(4-nitrobenzyl)-DOTA (CHEBI:42034) has functional parent DOTA (CHEBI:61028) |
| (S)-2-{4-[2-(2-hydroxyethylthio)acetamido]benzyl}-DOTA (CHEBI:42122) has functional parent DOTA (CHEBI:61028) |
| IUPAC Name |
|---|
| 2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl)tetraacetic acid |
| INNs | Source |
|---|---|
| tetraxetan | WHO MedNet |
| tetraxetán | WHO MedNet |
| tétraxétan | WHO MedNet |
| tetraxetanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,4,7,10-Dota | ChemIDplus |
| 1,4,7,10-Tetraazacyclododecane-1,4,7,10-tetraacetic acid | ChemIDplus |
| 1,4,7,10-Tetraazacyclododecane-N,N',N'',N'''-tetraacetic acid | ChemIDplus |
| 2,2',2',2'''-(1,4,7,10-Tetraazacyclododecane-1,4,7,10-tetryl)tetraacetic acid | ChemIDplus |
| DOTA acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D06092 | KEGG DRUG |
| DOTA_(chelator) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1186987 | Reaxys |
| CAS:60239-18-1 | ChemIDplus |
| Citations |
|---|