EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | CCC(C(=O)O)C1(O)CCCCC1 |
| InChI | InChI=1S/C10H18O3/c1-2-8(9(11)12)10(13)6-4-3-5-7-10/h8,13H,2-7H2,1H3,(H,11,12) |
| InChIKey | NIVFTEMPSCMWDE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | bile therapy drug A drug used in the treatment of bile or liver disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclobutyrol (CHEBI:61024) has role bile therapy drug (CHEBI:61026) |
| cyclobutyrol (CHEBI:61024) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| 2-(1-hydroxycyclohexyl)butanoic acid |
| INNs | Source |
|---|---|
| ciclobutirol | ChemIDplus |
| cyclobutyrol | ChemIDplus |
| cyclobutyrolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Cyclohexanol-α-butyric acid | ChemIDplus |
| 1-Hydroxy-α-ethylcyclohexylacetic acid | ChemIDplus |
| cyclobutyral | ChEBI |
| (RS)-2-(1-Hydroxycyclohexyl)buttersäure | ChemIDplus |
| α-(1-hydroxycyclohexyl)butyric acid | ChemIDplus |
| α-ethyl-1-hydroxycyclohexaneacetic acid | ChemIDplus |
| Citations |
|---|