EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O2 |
| Net Charge | 0 |
| Average Mass | 216.280 |
| Monoisotopic Mass | 216.11503 |
| SMILES | COc1ccc2cc([C@H](C)CO)ccc2c1 |
| InChI | InChI=1S/C14H16O2/c1-10(9-15)11-3-4-13-8-14(16-2)6-5-12(13)7-11/h3-8,10,15H,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | LTRANDSQVZFZDG-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naproxol (CHEBI:61022) has role antipyretic (CHEBI:35493) |
| naproxol (CHEBI:61022) has role non-narcotic analgesic (CHEBI:35481) |
| naproxol (CHEBI:61022) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| naproxol (CHEBI:61022) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| (2S)-2-(6-methoxy-2-naphthyl)propan-1-ol |
| INN | Source |
|---|---|
| naproxol | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (−)-2-(6-methoxy-2-naphthyl)-1-propanol | ChemIDplus |
| (−)-6-methoxy-β-methyl-2-naphthaleneethanol | ChemIDplus |
| (S)-(−)-2-(6-methoxy-2-naphthyl)-1-propanol | ChemIDplus |
| (−)-(S)-6-methoxy-β-methyl-2-naphthaleneethanol | ChemIDplus |
| NSC-758618 | ChEMBL |
| RS-4034 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7702132 | Reaxys |
| CAS:26159-36-4 | ChemIDplus |
| Citations |
|---|