EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32N4O3 |
| Net Charge | 0 |
| Average Mass | 508.622 |
| Monoisotopic Mass | 508.24744 |
| SMILES | Cc1cc(Cn2cnc3c2C[C@@H](C(=O)O)N(C(=O)C(c2ccccc2)c2ccccc2)C3)ccc1N(C)C |
| InChI | InChI=1S/C31H32N4O3/c1-21-16-22(14-15-26(21)33(2)3)18-34-20-32-25-19-35(28(31(37)38)17-27(25)34)30(36)29(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-16,20,28-29H,17-19H2,1-3H3,(H,37,38)/t28-/m0/s1 |
| InChIKey | YSTVFDAKLDMYCR-NDEPHWFRSA-N |
| Roles Classification |
|---|
| Biological Roles: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. vasoconstrictor agent Drug used to cause constriction of the blood vessels. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD123319 (CHEBI:61014) has role angiotensin receptor antagonist (CHEBI:61016) |
| PD123319 (CHEBI:61014) has role endothelin receptor antagonist (CHEBI:51451) |
| PD123319 (CHEBI:61014) has role vasoconstrictor agent (CHEBI:50514) |
| PD123319 (CHEBI:61014) is a imidazopyridine (CHEBI:46908) |
| IUPAC Name |
|---|
| (6S)-1-[4-(dimethylamino)-3-methylbenzyl]-5-(diphenylacetyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-6-carboxylic acid |
| Synonyms | Source |
|---|---|
| PD-123319 | ChemIDplus |
| PD 123319 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C15553 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4848847 | Reaxys |
| CAS:130663-39-7 | ChemIDplus |
| CAS:130663-39-7 | KEGG COMPOUND |
| Citations |
|---|