EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O5 |
| Net Charge | 0 |
| Average Mass | 344.367 |
| Monoisotopic Mass | 344.13722 |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O5/c19-15(9-11-1-5-13(21)6-2-11)17(23)20-16(18(24)25)10-12-3-7-14(22)8-4-12/h1-8,15-16,21-22H,9-10,19H2,(H,20,23)(H,24,25)/t15-,16-/m0/s1 |
| InChIKey | JAQGKXUEKGKTKX-HOTGVXAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-Tyr (CHEBI:60989) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Tyr-Tyr (CHEBI:60989) is a tyrosyltyrosine (CHEBI:60987) |
| IUPAC Name |
|---|
| L-tyrosyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| di-L-tyrosine | ChEBI |
| N-L-tyrosyl-L-tyrosine | ChEBI |
| H-L-Tyr-L-Tyr-OH | ChEBI |
| H-Tyr-Tyr-OH | ChEBI |
| Peptide tyrosine-tyrosine | ChemIDplus |
| L-Tyr-L-Tyr | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2676699 | Reaxys |
| CAS:1050-28-8 | ChemIDplus |