EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O16P2 |
| Net Charge | -2 |
| Average Mass | 548.287 |
| Monoisotopic Mass | 548.04555 |
| SMILES | CC1OC(OP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)C(O)C(O)C1O |
| InChI | InChI=1S/C15H24N2O16P2/c1-5-8(19)10(21)12(23)14(30-5)32-35(27,28)33-34(25,26)29-4-6-9(20)11(22)13(31-6)17-3-2-7(18)16-15(17)24/h2-3,5-6,8-14,19-23H,4H2,1H3,(H,25,26)(H,27,28)(H,16,18,24)/p-2/t5?,6-,8?,9-,10?,11-,12?,13-,14?/m1/s1 |
| InChIKey | DRDCJEIZVLVWNC-MJIHKOFYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-rhamnose(2−) (CHEBI:60981) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| UDP-rhamnose(2−) (CHEBI:60981) is conjugate base of UDP-rhamnose (CHEBI:63061) |
| Incoming Relation(s) |
| UDP-L-rhamnose(2−) (CHEBI:58153) is a UDP-rhamnose(2−) (CHEBI:60981) |
| UDP-rhamnose (CHEBI:63061) is conjugate acid of UDP-rhamnose(2−) (CHEBI:60981) |
| Synonyms | Source |
|---|---|
| UDP-rhamnose dianion | ChEBI |
| UDP-rhamnose dianions | ChEBI |