EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O3 |
| Net Charge | 0 |
| Average Mass | 292.419 |
| Monoisotopic Mass | 292.20384 |
| SMILES | CC/C=C\C/C=C\C=C\O/C=C/CCCCCCC(=O)O |
| InChI | InChI=1S/C18H28O3/c1-2-3-4-5-7-10-13-16-21-17-14-11-8-6-9-12-15-18(19)20/h3-4,7,10,13-14,16-17H,2,5-6,8-9,11-12,15H2,1H3,(H,19,20)/b4-3-,10-7-,16-13+,17-14+ |
| InChIKey | OYKAXBUWOIRLGF-VMBRNALUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colnelenic acid (CHEBI:60959) is a divinyl ether fatty acid (CHEBI:61411) |
| colnelenic acid (CHEBI:60959) is a long-chain fatty acid (CHEBI:15904) |
| colnelenic acid (CHEBI:60959) is a straight-chain fatty acid (CHEBI:59202) |
| colnelenic acid (CHEBI:60959) is conjugate acid of colnelenate (CHEBI:60960) |
| Incoming Relation(s) |
| colnelenate (CHEBI:60960) is conjugate base of colnelenic acid (CHEBI:60959) |
| IUPAC Name |
|---|
| (8E)-9-[(1E,3Z,6Z)-nona-1,3,6-trien-1-yloxy]non-8-enoic acid |
| Synonyms | Source |
|---|---|
| acide colnelénique | ChEBI |
| (8E)-9-[(1E,3Z,6Z)-nona-1,3,6-trien-1-yloxy]-8-nonenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:52591-16-9 | ChemIDplus |
| CAS:52591-16-9 | KEGG COMPOUND |
| Citations |
|---|